C20H31N3O3 — CID 97149015
(3S)-1-(2-amino-2-oxoethyl)-N-[3-(2,4-dimethylphenoxy)propyl]-N-methylpiperidine-3-carboxamide (PubChem CID 97149015) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is (3S)-1-(2-amino-2-oxoethyl)-N-[3-(2,4-dimethylphenoxy)propyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-amino-2-oxoethyl)-N-[3-(2,4-dimethylphenoxy)propyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97149015 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (3S)-1-(2-amino-2-oxoethyl)-N-[3-(2,4-dimethylphenoxy)propyl]-N-methylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(OCCCN(C)C(=O)[C@H]2CCCN(CC(N)=O)C2)c(C)c1 |
| InChI | InChI=1S/C20H31N3O3/c1-15-7-8-18(16(2)12-15)26-11-5-9-22(3)20(25)17-6-4-10-23(13-17)14-19(21)24/h7-8,12,17H,4-6,9-11,13-14H2,1-3H3,(H2,21,24)/t17-/m0/s1 |
| InChIKey | GCTZNZPOGQLUKR-KRWDZBQOSA-N |
| XLogP | 1.73 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|