C20H33N3O2 — CID 122562465
1-[3-(2,4-dimethylphenoxy)propyl]-1-methyl-3-(1-pyrrolidin-1-ylpropan-2-yl)urea (PubChem CID 122562465) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenoxy)propyl]-1-methyl-3-(1-pyrrolidin-1-ylpropan-2-yl)urea.
| Compound Name | 1-[3-(2,4-dimethylphenoxy)propyl]-1-methyl-3-(1-pyrrolidin-1-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 122562465 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-[3-(2,4-dimethylphenoxy)propyl]-1-methyl-3-(1-pyrrolidin-1-ylpropan-2-yl)urea |
| SMILES | Cc1ccc(OCCCN(C)C(=O)NC(C)CN2CCCC2)c(C)c1 |
| InChI | InChI=1S/C20H33N3O2/c1-16-8-9-19(17(2)14-16)25-13-7-10-22(4)20(24)21-18(3)15-23-11-5-6-12-23/h8-9,14,18H,5-7,10-13,15H2,1-4H3,(H,21,24) |
| InChIKey | DRNVVEWCSDBZKS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|