About N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride
N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride (PubChem CID 24832267) has the molecular formula C19H31ClN2O2
and a molecular weight of 354.92 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride |
| PubChem CID | 24832267 |
| Molecular Formula | C19H31ClN2O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride |
| SMILES | CCN(C(=O)CN1CCCC1)C(C)COc1ccc(C)cc1C.Cl |
| InChI | InChI=1S/C19H30N2O2.ClH/c1-5-21(19(22)13-20-10-6-7-11-20)17(4)14-23-18-9-8-15(2)12-16(18)3;/h8-9,12,17H,5-7,10-11,13-14H2,1-4H3;1H |
| InChIKey | YVYFSAUYZMPSKK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride?
The IUPAC name of N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride (CID 24832267) is N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride.
What is the SMILES notation for N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride?
The canonical SMILES for N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride is CCN(C(=O)CN1CCCC1)C(C)COc1ccc(C)cc1C.Cl.
What is the InChIKey of N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride?
The InChIKey is YVYFSAUYZMPSKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O2.ClH/c1-5-21(19(22)13-20-10-6-7-11-20)17(4)14-23-18-9-8-15(2)12-16(18)3;/h8-9,12,17H,5-7,10-11,13-14H2,1-4H3;1H.
What are the key properties of N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride?
N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride has a molecular weight of 354.92 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,4-dimethylphenoxy)propan-2-yl]-N-ethyl-2-pyrrolidin-1-ylacetamide;hydrochloride is sourced from PubChem (CID 24832267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).