C17H25NO — CID 43219875
2-(azocan-1-yl)-1-(2,4-dimethylphenyl)ethanone (PubChem CID 43219875) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-(azocan-1-yl)-1-(2,4-dimethylphenyl)ethanone.
| Compound Name | 2-(azocan-1-yl)-1-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 43219875 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(azocan-1-yl)-1-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)CN2CCCCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H25NO/c1-14-8-9-16(15(2)12-14)17(19)13-18-10-6-4-3-5-7-11-18/h8-9,12H,3-7,10-11,13H2,1-2H3 |
| InChIKey | CGHPRMIPQXEPIW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |