C18H27NO — CID 43219868
2-(azocan-1-yl)-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 43219868) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-(azocan-1-yl)-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-(azocan-1-yl)-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 43219868 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-(azocan-1-yl)-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CN2CCCCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H27NO/c1-14-11-15(2)18(16(3)12-14)17(20)13-19-9-7-5-4-6-8-10-19/h11-12H,4-10,13H2,1-3H3 |
| InChIKey | SIJUSMJSCSVKFP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |