C20H30N2O — CID 90643116
2-(4-cyclohexylpiperazin-1-yl)-1-(2,4-dimethylphenyl)ethanone (PubChem CID 90643116) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(4-cyclohexylpiperazin-1-yl)-1-(2,4-dimethylphenyl)ethanone.
| Compound Name | 2-(4-cyclohexylpiperazin-1-yl)-1-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 90643116 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-(4-cyclohexylpiperazin-1-yl)-1-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)CN2CCN(C3CCCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H30N2O/c1-16-8-9-19(17(2)14-16)20(23)15-21-10-12-22(13-11-21)18-6-4-3-5-7-18/h8-9,14,18H,3-7,10-13,15H2,1-2H3 |
| InChIKey | HVLQXPSRXABSOR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |