C18H26N4O4 — CID 154908783
1-[3-(2,4-dimethylphenoxy)propyl]-3-(1H-imidazol-2-ylmethyl)-1-methylurea;formic acid (PubChem CID 154908783) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenoxy)propyl]-3-(1H-imidazol-2-ylmethyl)-1-methylurea;formic acid.
| Compound Name | 1-[3-(2,4-dimethylphenoxy)propyl]-3-(1H-imidazol-2-ylmethyl)-1-methylurea;formic acid |
|---|---|
| PubChem CID | 154908783 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[3-(2,4-dimethylphenoxy)propyl]-3-(1H-imidazol-2-ylmethyl)-1-methylurea;formic acid |
| SMILES | Cc1ccc(OCCCN(C)C(=O)NCc2ncc[nH]2)c(C)c1.O=CO |
| InChI | InChI=1S/C17H24N4O2.CH2O2/c1-13-5-6-15(14(2)11-13)23-10-4-9-21(3)17(22)20-12-16-18-7-8-19-16;2-1-3/h5-8,11H,4,9-10,12H2,1-3H3,(H,18,19)(H,20,22);1H,(H,2,3) |
| InChIKey | RRWOFYIMAZXUOD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|