C17H24ClN3O2S — CID 70769016
3-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide (PubChem CID 70769016) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is 3-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70769016 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCCC(C(=O)NCCCSCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H24ClN3O2S/c18-15-7-2-1-5-14(15)12-24-10-4-8-20-16(22)13-6-3-9-21(11-13)17(19)23/h1-2,5,7,13H,3-4,6,8-12H2,(H2,19,23)(H,20,22) |
| InChIKey | GFCSNKPKBBXCRD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|