C14H17ClFN3O2 — CID 97116009
(3R)-3-N-[(2-chloro-4-fluorophenyl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 97116009) has the molecular formula C14H17ClFN3O2 and a molecular weight of 313.76 g/mol. Its IUPAC name is (3R)-3-N-[(2-chloro-4-fluorophenyl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[(2-chloro-4-fluorophenyl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97116009 |
| Molecular Formula | C14H17ClFN3O2 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (3R)-3-N-[(2-chloro-4-fluorophenyl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)NCc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H17ClFN3O2/c15-12-6-11(16)4-3-9(12)7-18-13(20)10-2-1-5-19(8-10)14(17)21/h3-4,6,10H,1-2,5,7-8H2,(H2,17,21)(H,18,20)/t10-/m1/s1 |
| InChIKey | YUBYAZCXZBLLNO-SNVBAGLBSA-N |
| XLogP | 1.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |