C17H25ClFN3O2 — CID 120632447
(2S,4S)-N-[3-[(4-fluorobenzoyl)amino]propyl]-2-methylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120632447) has the molecular formula C17H25ClFN3O2 and a molecular weight of 357.86 g/mol. Its IUPAC name is (2S,4S)-N-[3-[(4-fluorobenzoyl)amino]propyl]-2-methylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[3-[(4-fluorobenzoyl)amino]propyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120632447 |
| Molecular Formula | C17H25ClFN3O2 |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (2S,4S)-N-[3-[(4-fluorobenzoyl)amino]propyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCCNC(=O)c2ccc(F)cc2)CCN1.Cl |
| InChI | InChI=1S/C17H24FN3O2.ClH/c1-12-11-14(7-10-19-12)17(23)21-9-2-8-20-16(22)13-3-5-15(18)6-4-13;/h3-6,12,14,19H,2,7-11H2,1H3,(H,20,22)(H,21,23);1H/t12-,14-;/m0./s1 |
| InChIKey | DGXZYCISZDQLPX-KYSPHBLOSA-N |
| XLogP | 1.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|