C10H22ClN3O4S — CID 120924338
(2R,3S)-N-[2-(ethylsulfonylamino)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride (PubChem CID 120924338) has the molecular formula C10H22ClN3O4S and a molecular weight of 315.82 g/mol. Its IUPAC name is (2R,3S)-N-[2-(ethylsulfonylamino)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-N-[2-(ethylsulfonylamino)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120924338 |
| Molecular Formula | C10H22ClN3O4S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2R,3S)-N-[2-(ethylsulfonylamino)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride |
| SMILES | CCS(=O)(=O)NCCNC(=O)[C@H]1NCCO[C@@H]1C.Cl |
| InChI | InChI=1S/C10H21N3O4S.ClH/c1-3-18(15,16)13-5-4-12-10(14)9-8(2)17-7-6-11-9;/h8-9,11,13H,3-7H2,1-2H3,(H,12,14);1H/t8-,9+;/m1./s1 |
| InChIKey | JDCWASFWAJCNJH-RJUBDTSPSA-N |
| XLogP | -1.16 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|