C14H20N4O6S — CID 120928111
(2R,3S)-2-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]morpholine-3-carboxamide (PubChem CID 120928111) has the molecular formula C14H20N4O6S and a molecular weight of 372.40 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120928111 |
| Molecular Formula | C14H20N4O6S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2R,3S)-2-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]morpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)NCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N4O6S/c1-10-13(15-8-9-24-10)14(19)16-6-7-17-25(22,23)12-4-2-11(3-5-12)18(20)21/h2-5,10,13,15,17H,6-9H2,1H3,(H,16,19)/t10-,13+/m1/s1 |
| InChIKey | UPMDJJMKVVFMQN-MFKMUULPSA-N |
| XLogP | -0.63 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|