C16H22N4O6S — CID 108572388
N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 108572388) has the molecular formula C16H22N4O6S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108572388 |
| Molecular Formula | C16H22N4O6S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)N1CC(C(=O)NCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1=O |
| InChI | InChI=1S/C16H22N4O6S/c1-11(2)19-10-12(9-15(19)21)16(22)17-7-8-18-27(25,26)14-5-3-13(4-6-14)20(23)24/h3-6,11-12,18H,7-10H2,1-2H3,(H,17,22) |
| InChIKey | RXSDNFLRZLSNOS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|