C12H17ClN4O5S2 — CID 119305408
N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119305408) has the molecular formula C12H17ClN4O5S2 and a molecular weight of 396.88 g/mol. Its IUPAC name is N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119305408 |
| Molecular Formula | C12H17ClN4O5S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C1CSCN1 |
| InChI | InChI=1S/C12H16N4O5S2.ClH/c17-12(11-7-22-8-14-11)13-5-6-15-23(20,21)10-3-1-9(2-4-10)16(18)19;/h1-4,11,14-15H,5-8H2,(H,13,17);1H |
| InChIKey | AAAYEGVJXULDEK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|