C13H18N4O6S — CID 119755120
4-hydroxy-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide (PubChem CID 119755120) has the molecular formula C13H18N4O6S and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119755120 |
| Molecular Formula | C13H18N4O6S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-hydroxy-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)C1CC(O)CN1 |
| InChI | InChI=1S/C13H18N4O6S/c18-10-7-12(15-8-10)13(19)14-4-5-16-24(22,23)11-3-1-2-9(6-11)17(20)21/h1-3,6,10,12,15-16,18H,4-5,7-8H2,(H,14,19) |
| InChIKey | VRGQFNRAXDKESS-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|