C20H26N4O5S — CID 56552597
2-(diethylamino)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-2-phenylacetamide (PubChem CID 56552597) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-(diethylamino)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-2-phenylacetamide.
| Compound Name | 2-(diethylamino)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 56552597 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(diethylamino)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-2-phenylacetamide |
| SMILES | CCN(CC)C(C(=O)NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C20H26N4O5S/c1-3-23(4-2)19(16-9-6-5-7-10-16)20(25)21-13-14-22-30(28,29)18-12-8-11-17(15-18)24(26)27/h5-12,15,19,22H,3-4,13-14H2,1-2H3,(H,21,25) |
| InChIKey | KABFQCRSUOREKS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|