C16H17N3O7S2 — CID 55542230
4-methylsulfonyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]benzamide (PubChem CID 55542230) has the molecular formula C16H17N3O7S2 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]benzamide.
| Compound Name | 4-methylsulfonyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55542230 |
| Molecular Formula | C16H17N3O7S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 4-methylsulfonyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H17N3O7S2/c1-27(23,24)14-7-5-12(6-8-14)16(20)17-9-10-18-28(25,26)15-4-2-3-13(11-15)19(21)22/h2-8,11,18H,9-10H2,1H3,(H,17,20) |
| InChIKey | MLLSVXMJRHAHJO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 152.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|