C19H20N4O6S — CID 166404445
N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 166404445) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 166404445 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)NCCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H20N4O6S/c1-2-18(24)21-13-14-6-8-15(9-7-14)19(25)20-10-11-22-30(28,29)17-5-3-4-16(12-17)23(26)27/h2-9,12,22H,1,10-11,13H2,(H,20,25)(H,21,24) |
| InChIKey | JTCQUALELKKYRV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|