C30H24N6O8 — CID 22152538
4-N-(3-nitrophenyl)-1-N-[2-[[4-[(3-nitrophenyl)carbamoyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide (PubChem CID 22152538) has the molecular formula C30H24N6O8 and a molecular weight of 596.56 g/mol. Its IUPAC name is 4-N-(3-nitrophenyl)-1-N-[2-[[4-[(3-nitrophenyl)carbamoyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(3-nitrophenyl)-1-N-[2-[[4-[(3-nitrophenyl)carbamoyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 22152538 |
| Molecular Formula | C30H24N6O8 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 4-N-(3-nitrophenyl)-1-N-[2-[[4-[(3-nitrophenyl)carbamoyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide |
| SMILES | O=C(NCCNC(=O)c1ccc(C(=O)Nc2cccc([N+](=O)[O-])c2)cc1)c1ccc(C(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H24N6O8/c37-27(19-7-11-21(12-8-19)29(39)33-23-3-1-5-25(17-23)35(41)42)31-15-16-32-28(38)20-9-13-22(14-10-20)30(40)34-24-4-2-6-26(18-24)36(43)44/h1-14,17-18H,15-16H2,(H,31,37)(H,32,38)(H,33,39)(H,34,40) |
| InChIKey | QFDVSQKJODDHJT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 202.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|