C20H14N4O7 — CID 15745029
5-hydroxy-1-N,3-N-bis(3-nitrophenyl)benzene-1,3-dicarboxamide (PubChem CID 15745029) has the molecular formula C20H14N4O7 and a molecular weight of 422.35 g/mol. Its IUPAC name is 5-hydroxy-1-N,3-N-bis(3-nitrophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-hydroxy-1-N,3-N-bis(3-nitrophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 15745029 |
| Molecular Formula | C20H14N4O7 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 5-hydroxy-1-N,3-N-bis(3-nitrophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1cc(O)cc(C(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H14N4O7/c25-18-8-12(19(26)21-14-3-1-5-16(10-14)23(28)29)7-13(9-18)20(27)22-15-4-2-6-17(11-15)24(30)31/h1-11,25H,(H,21,26)(H,22,27) |
| InChIKey | WIHSSGIVCGNOKH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|