C17H13F6N3O5S — CID 60593476
N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 60593476) has the molecular formula C17H13F6N3O5S and a molecular weight of 485.36 g/mol. Its IUPAC name is N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 60593476 |
| Molecular Formula | C17H13F6N3O5S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F6N3O5S/c18-16(19,20)11-6-10(7-12(8-11)17(21,22)23)15(27)24-4-5-25-32(30,31)14-3-1-2-13(9-14)26(28)29/h1-3,6-9,25H,4-5H2,(H,24,27) |
| InChIKey | IALKTSCALAIIPY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|