C19H17N3O5S2 — CID 60593082
N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-phenylthiophene-2-carboxamide (PubChem CID 60593082) has the molecular formula C19H17N3O5S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-phenylthiophene-2-carboxamide.
| Compound Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60593082 |
| Molecular Formula | C19H17N3O5S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C19H17N3O5S2/c23-19(18-17(9-12-28-18)14-5-2-1-3-6-14)20-10-11-21-29(26,27)16-8-4-7-15(13-16)22(24)25/h1-9,12-13,21H,10-11H2,(H,20,23) |
| InChIKey | KSEYRRYYDMLMBA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|