C18H23N5O4S — CID 110950742
1-benzyl-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 110950742) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-benzyl-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 110950742 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H23N5O4S/c1-19-18(22(2)14-15-7-4-3-5-8-15)20-11-12-21-28(26,27)17-10-6-9-16(13-17)23(24)25/h3-10,13,21H,11-12,14H2,1-2H3,(H,19,20) |
| InChIKey | ULANRSSKKHUVMM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|