C19H25N5O5S — CID 111271565
1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 111271565) has the molecular formula C19H25N5O5S and a molecular weight of 435.51 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 111271565 |
| Molecular Formula | C19H25N5O5S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H25N5O5S/c1-20-19(23(2)14-15-7-9-17(29-3)10-8-15)21-11-12-22-30(27,28)18-6-4-5-16(13-18)24(25)26/h4-10,13,22H,11-12,14H2,1-3H3,(H,20,21) |
| InChIKey | HOFIJMBJXZXNEL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|