C17H27N5O4S — CID 109452697
N',2,2,3,3-pentamethyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]azetidine-1-carboximidamide (PubChem CID 109452697) has the molecular formula C17H27N5O4S and a molecular weight of 397.50 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]azetidine-1-carboximidamide.
| Compound Name | N',2,2,3,3-pentamethyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452697 |
| Molecular Formula | C17H27N5O4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]azetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C17H27N5O4S/c1-16(2)12-21(17(16,3)4)15(18-5)19-9-10-20-27(25,26)14-8-6-7-13(11-14)22(23)24/h6-8,11,20H,9-10,12H2,1-5H3,(H,18,19) |
| InChIKey | RFJTVWXUBFRRNW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|