C19H25N7O4S — CID 111219453
N'-methyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111219453) has the molecular formula C19H25N7O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N'-methyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111219453 |
| Molecular Formula | C19H25N7O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N'-methyl-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H25N7O4S/c1-20-19(25-13-11-24(12-14-25)18-7-2-3-8-21-18)22-9-10-23-31(29,30)17-6-4-5-16(15-17)26(27)28/h2-8,15,23H,9-14H2,1H3,(H,20,22) |
| InChIKey | WDWUOQIFBJOCJO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|