C20H27N5 — CID 111219325
N'-methyl-N-[2-(3-methylphenyl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111219325) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N'-methyl-N-[2-(3-methylphenyl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(3-methylphenyl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111219325 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N'-methyl-N-[2-(3-methylphenyl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1cccc(C)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H27N5/c1-17-6-5-7-18(16-17)9-11-23-20(21-2)25-14-12-24(13-15-25)19-8-3-4-10-22-19/h3-8,10,16H,9,11-15H2,1-2H3,(H,21,23) |
| InChIKey | KHVXMKKDDJZTKI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|