C17H22BrN5S — CID 111220483
N-[2-(5-bromothiophen-2-yl)ethyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111220483) has the molecular formula C17H22BrN5S and a molecular weight of 408.37 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111220483 |
| Molecular Formula | C17H22BrN5S |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1ccc(Br)s1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H22BrN5S/c1-19-17(21-9-7-14-5-6-15(18)24-14)23-12-10-22(11-13-23)16-4-2-3-8-20-16/h2-6,8H,7,9-13H2,1H3,(H,19,21) |
| InChIKey | FVNRAZNOTSPAEO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|