C18H27N5O4S — CID 111208482
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 111208482) has the molecular formula C18H27N5O4S and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 111208482 |
| Molecular Formula | C18H27N5O4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H27N5O4S/c1-19-18(20-11-10-15-6-3-2-4-7-15)21-12-13-22-28(26,27)17-9-5-8-16(14-17)23(24)25/h5-6,8-9,14,22H,2-4,7,10-13H2,1H3,(H2,19,20,21) |
| InChIKey | GMXHCGGWUFLLNK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|