C15H21NO4S2 — CID 110759188
N-[2-(cyclohexen-1-yl)ethyl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 110759188) has the molecular formula C15H21NO4S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 110759188 |
| Molecular Formula | C15H21NO4S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C15H21NO4S2/c1-21(17,18)14-8-5-9-15(12-14)22(19,20)16-11-10-13-6-3-2-4-7-13/h5-6,8-9,12,16H,2-4,7,10-11H2,1H3 |
| InChIKey | GKRWUUXBIBAQAB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|