C19H29N3O3S — CID 109063514
3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 109063514) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 109063514 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(S(=O)(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C19H29N3O3S/c1-22(2)14-13-20-19(23)17-9-6-10-18(15-17)26(24,25)21-12-11-16-7-4-3-5-8-16/h6-7,9-10,15,21H,3-5,8,11-14H2,1-2H3,(H,20,23) |
| InChIKey | WIYNFQRFWHTRAV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|