C14H16ClNO3S — CID 106173095
3-[2-(cyclopenten-1-yl)ethylcarbamoyl]benzenesulfonyl chloride (PubChem CID 106173095) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is 3-[2-(cyclopenten-1-yl)ethylcarbamoyl]benzenesulfonyl chloride.
| Compound Name | 3-[2-(cyclopenten-1-yl)ethylcarbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 106173095 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 3-[2-(cyclopenten-1-yl)ethylcarbamoyl]benzenesulfonyl chloride |
| SMILES | O=C(NCCC1=CCCC1)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C14H16ClNO3S/c15-20(18,19)13-7-3-6-12(10-13)14(17)16-9-8-11-4-1-2-5-11/h3-4,6-7,10H,1-2,5,8-9H2,(H,16,17) |
| InChIKey | KOIUHETWRAOKLK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|