C20H29N3O2 — CID 109052412
1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(dimethylamino)ethyl]benzene-1,3-dicarboxamide (PubChem CID 109052412) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(dimethylamino)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(dimethylamino)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109052412 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(dimethylamino)ethyl]benzene-1,3-dicarboxamide |
| SMILES | CN(C)CCNC(=O)c1cccc(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-23(2)14-13-22-20(25)18-10-6-9-17(15-18)19(24)21-12-11-16-7-4-3-5-8-16/h6-7,9-10,15H,3-5,8,11-14H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | SQJCSYIBLNRARB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|