C20H30N4O2 — CID 109081949
4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-[3-(dimethylamino)propyl]pyridine-2,4-dicarboxamide (PubChem CID 109081949) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-[3-(dimethylamino)propyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-[3-(dimethylamino)propyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081949 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-[3-(dimethylamino)propyl]pyridine-2,4-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(C(=O)NCCC2=CCCCC2)ccn1 |
| InChI | InChI=1S/C20H30N4O2/c1-24(2)14-6-11-22-20(26)18-15-17(10-13-21-18)19(25)23-12-9-16-7-4-3-5-8-16/h7,10,13,15H,3-6,8-9,11-12,14H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | GUJXHJLBRPPTPW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|