C22H23N3O4 — CID 109082123
4-N-(1,3-benzodioxol-5-yl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide (PubChem CID 109082123) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082123 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccnc(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C22H23N3O4/c26-21(25-17-6-7-19-20(13-17)29-14-28-19)16-9-11-23-18(12-16)22(27)24-10-8-15-4-2-1-3-5-15/h4,6-7,9,11-13H,1-3,5,8,10,14H2,(H,24,27)(H,25,26) |
| InChIKey | PJTKBULIXGFAST-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|