C19H21N3O5 — CID 109082770
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide (PubChem CID 109082770) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082770 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1cc(C(=O)Nc2ccc3c(c2)OCCO3)ccn1 |
| InChI | InChI=1S/C19H21N3O5/c1-25-8-2-6-21-19(24)15-11-13(5-7-20-15)18(23)22-14-3-4-16-17(12-14)27-10-9-26-16/h3-5,7,11-12H,2,6,8-10H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | SRNRPZVUGSUUBN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|