C18H21N3O4 — CID 109167122
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(3-methoxypropyl)pyridine-4-carboxamide (PubChem CID 109167122) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(3-methoxypropyl)pyridine-4-carboxamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(3-methoxypropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109167122 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(3-methoxypropyl)pyridine-4-carboxamide |
| SMILES | COCCCNC(=O)c1ccnc(Nc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-23-8-2-6-20-18(22)13-5-7-19-17(11-13)21-14-3-4-15-16(12-14)25-10-9-24-15/h3-5,7,11-12H,2,6,8-10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | GDCZBIGQUXQTRD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|