C17H17F2N3O3 — CID 109082791
4-N-(3,4-difluorophenyl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide (PubChem CID 109082791) has the molecular formula C17H17F2N3O3 and a molecular weight of 349.34 g/mol. Its IUPAC name is 4-N-(3,4-difluorophenyl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3,4-difluorophenyl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082791 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-N-(3,4-difluorophenyl)-2-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1cc(C(=O)Nc2ccc(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C17H17F2N3O3/c1-25-8-2-6-21-17(24)15-9-11(5-7-20-15)16(23)22-12-3-4-13(18)14(19)10-12/h3-5,7,9-10H,2,6,8H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | FVRPQUIDPFDPIB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|