C17H18BrN3O3 — CID 109082614
2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide (PubChem CID 109082614) has the molecular formula C17H18BrN3O3 and a molecular weight of 392.25 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082614 |
| Molecular Formula | C17H18BrN3O3 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1ccnc(C(=O)Nc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C17H18BrN3O3/c1-24-9-3-7-20-16(22)12-6-8-19-15(10-12)17(23)21-14-5-2-4-13(18)11-14/h2,4-6,8,10-11H,3,7,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | BVWBFWLDHPLBFG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|