C21H22ClN3O2 — CID 109082107
4-N-(3-chlorophenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide (PubChem CID 109082107) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3-chlorophenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082107 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-N-(3-chlorophenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccnc(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C21H22ClN3O2/c22-17-7-4-8-18(14-17)25-20(26)16-10-12-23-19(13-16)21(27)24-11-9-15-5-2-1-3-6-15/h4-5,7-8,10,12-14H,1-3,6,9,11H2,(H,24,27)(H,25,26) |
| InChIKey | BZUWMQKPSHBAOM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|