C20H23ClN4O2S — CID 16897441
2-[(3-chlorophenyl)carbamoylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 16897441) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)carbamoylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 16897441 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)Nc2cccc(Cl)c2)sc1C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H23ClN4O2S/c1-13-17(18(26)22-11-10-14-6-3-2-4-7-14)28-20(23-13)25-19(27)24-16-9-5-8-15(21)12-16/h5-6,8-9,12H,2-4,7,10-11H2,1H3,(H,22,26)(H2,23,24,25,27) |
| InChIKey | WGNPXHHFXDHDTE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|