C21H23N3O3 — CID 109227479
5-(1,3-benzodioxol-5-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-carboxamide (PubChem CID 109227479) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109227479 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cncc(Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C21H23N3O3/c25-21(23-9-8-15-4-2-1-3-5-15)16-10-18(13-22-12-16)24-17-6-7-19-20(11-17)27-14-26-19/h4,6-7,10-13,24H,1-3,5,8-9,14H2,(H,23,25) |
| InChIKey | HJJTXHHJCLQPKU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|