C23H31N3O2 — CID 109103293
3-N,5-N-bis[2-(cyclohexen-1-yl)ethyl]pyridine-3,5-dicarboxamide (PubChem CID 109103293) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-N,5-N-bis[2-(cyclohexen-1-yl)ethyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[2-(cyclohexen-1-yl)ethyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103293 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 3-N,5-N-bis[2-(cyclohexen-1-yl)ethyl]pyridine-3,5-dicarboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cncc(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C23H31N3O2/c27-22(25-13-11-18-7-3-1-4-8-18)20-15-21(17-24-16-20)23(28)26-14-12-19-9-5-2-6-10-19/h7,9,15-17H,1-6,8,10-14H2,(H,25,27)(H,26,28) |
| InChIKey | FRWQSEDIGRNQLY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|