C19H22N4O3 — CID 109103388
3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide (PubChem CID 109103388) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103388 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide |
| SMILES | Cc1cc(NC(=O)c2cncc(C(=O)NCCC3=CCCCC3)c2)no1 |
| InChI | InChI=1S/C19H22N4O3/c1-13-9-17(23-26-13)22-19(25)16-10-15(11-20-12-16)18(24)21-8-7-14-5-3-2-4-6-14/h5,9-12H,2-4,6-8H2,1H3,(H,21,24)(H,22,23,25) |
| InChIKey | LDIWZLIBPGCEDF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|