C17H21N5O2 — CID 109251154
N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidine-5-carboxamide (PubChem CID 109251154) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109251154 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidine-5-carboxamide |
| SMILES | Cc1cc(Nc2ncc(C(=O)NCCC3=CCCCC3)cn2)no1 |
| InChI | InChI=1S/C17H21N5O2/c1-12-9-15(22-24-12)21-17-19-10-14(11-20-17)16(23)18-8-7-13-5-3-2-4-6-13/h5,9-11H,2-4,6-8H2,1H3,(H,18,23)(H,19,20,21,22) |
| InChIKey | IOSLOWZDLBRYKN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|