C16H24N4O — CID 109246675
N-[2-(cyclohexen-1-yl)ethyl]-2-(propylamino)pyrimidine-5-carboxamide (PubChem CID 109246675) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(propylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(propylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109246675 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(propylamino)pyrimidine-5-carboxamide |
| SMILES | CCCNc1ncc(C(=O)NCCC2=CCCCC2)cn1 |
| InChI | InChI=1S/C16H24N4O/c1-2-9-18-16-19-11-14(12-20-16)15(21)17-10-8-13-6-4-3-5-7-13/h6,11-12H,2-5,7-10H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | RQJZLKBSZHNZNE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|