C21H25N5O2 — CID 109251271
N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]pyrimidine-5-carboxamide (PubChem CID 109251271) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]pyrimidine-5-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109251271 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]pyrimidine-5-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cnc(NCCC3=CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C21H25N5O2/c1-15(27)25-18-7-9-19(10-8-18)26-20(28)17-13-23-21(24-14-17)22-12-11-16-5-3-2-4-6-16/h5,7-10,13-14H,2-4,6,11-12H2,1H3,(H,25,27)(H,26,28)(H,22,23,24) |
| InChIKey | AUSBAVCOLQBFST-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|