C24H26N2O3 — CID 109045058
4-N-(4-acetylphenyl)-1-N-[2-(cyclohexen-1-yl)ethyl]benzene-1,4-dicarboxamide (PubChem CID 109045058) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-N-(4-acetylphenyl)-1-N-[2-(cyclohexen-1-yl)ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-acetylphenyl)-1-N-[2-(cyclohexen-1-yl)ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109045058 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-N-(4-acetylphenyl)-1-N-[2-(cyclohexen-1-yl)ethyl]benzene-1,4-dicarboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(C(=O)NCCC3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-17(27)19-11-13-22(14-12-19)26-24(29)21-9-7-20(8-10-21)23(28)25-16-15-18-5-3-2-4-6-18/h5,7-14H,2-4,6,15-16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | BVNJAWYEEBZLTM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|