C14H17NOS — CID 114153830
N-[2-(cyclopenten-1-yl)ethyl]-4-sulfanylbenzamide (PubChem CID 114153830) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-4-sulfanylbenzamide.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-4-sulfanylbenzamide |
|---|---|
| PubChem CID | 114153830 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-4-sulfanylbenzamide |
| SMILES | O=C(NCCC1=CCCC1)c1ccc(S)cc1 |
| InChI | InChI=1S/C14H17NOS/c16-14(12-5-7-13(17)8-6-12)15-10-9-11-3-1-2-4-11/h3,5-8,17H,1-2,4,9-10H2,(H,15,16) |
| InChIKey | FTXAZSOEKDMPLJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|