C14H16BrNOS — CID 106173273
2-bromo-N-[2-(cyclopenten-1-yl)ethyl]-5-sulfanylbenzamide (PubChem CID 106173273) has the molecular formula C14H16BrNOS and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-bromo-N-[2-(cyclopenten-1-yl)ethyl]-5-sulfanylbenzamide.
| Compound Name | 2-bromo-N-[2-(cyclopenten-1-yl)ethyl]-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 106173273 |
| Molecular Formula | C14H16BrNOS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-bromo-N-[2-(cyclopenten-1-yl)ethyl]-5-sulfanylbenzamide |
| SMILES | O=C(NCCC1=CCCC1)c1cc(S)ccc1Br |
| InChI | InChI=1S/C14H16BrNOS/c15-13-6-5-11(18)9-12(13)14(17)16-8-7-10-3-1-2-4-10/h3,5-6,9,18H,1-2,4,7-8H2,(H,16,17) |
| InChIKey | XZAVOHFUKLFGRC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|